[damac]

Hi guys and girls first i would like to thank you all for your help during my organic chemistry course,  I am now just doing my final assignment and the my final exam.

 when reacting isoprene with bromine in carbon tetrachloride

CH2=C(CH3)-CH=CH2 + Br2 --> CH2(Br)-C(CH3)=CH-CH2(Br) + CH2(Br)-C(CH3)(Br)-CH=CH2

does this look correct??

reacting isoprene with excess hydrogen gas in presence of a PtO2 catalyst

?

reacting isoprene with excess mercury(II) acetate and metnanol, followed by sodium borohydride

?

reacting isoprene with excess ozone followed by zinc acetic acid

CH2=C(CH3)-CH=CH2  + O3 + Zn ---> CH2=O  + CH3CH2CH=O + CH3

does this look correct?

[dexangeles]

your 2 answers look good

what did you get for the other 2?
hints:

1.hydrogenation
2. oxymercuration - borohydride reduction

[damac]

thank you very much for the hints my answer to the other two are

reacting isoprene with exess hydrogen gas in the presence of a PtO2 catalyst

CH2=C(CH3)-CH=CH2 + H2 + Catalyst --> CH3-CH(CH3)-CH=CH2

and reacting isoprene with excess mercury(II) acetate and methanol, follwed by sodium borohydride

CH2=C(CH3)-CH=CH2 + 1. Hg(OAc)2 + 2. NaBH4 --> CH3-C(OH)(CH3)-CH=CH2

does this look correct??