[coolein]

1) NAD+ and FAD are two coenzymes that often help in enzyme catalysis by carrying electrons and protons from one compound to another. Explain which type of transformation NAD+ one carries out (ex. hydrolysis of ester to carboxylic acid and alcohol) and show one specific example.

NAD+ just carries electrons from molecule to molecule (a redox transformation?)


2) Draw a sphingolipid containing lineloeic acid and serine.

I am really confused on how to connect the acid and AA to the body. There should be a general backbone and a hydrophilic head right?

[Whistling_Shoggoth]

2) According to Wikipedia, the serine should be linked to the backbone via an ester bond (i.e. R = serine in the figure below), whereas the linoleic acid (or is it linolenic? I've never heard of lineloeic acid) is attached through an amide bond.

[coolein]

Anybody know what question one is referring to?

2) I have it drawn such as the CH2O-Serine --> CH2O-C=O-CH2-(NH2)-CH2-OH  and the C1 of the linolenic acid is attached to the NH (but on OH present)