[nothincomin]

a) CH3CH2CO(CH2)3CH(CH3)CH2CH3

I know that this compound is a ketone, but I don't know how you would bond the 3 (CH2) with the CO

[Borek]

(CH₂)₃ = -CH₂-CH₂-CH₂-

[Juicebox]

3-methyl-1-propoxyheptane

[nothincomin]

What I mean is that after you double bond the C and O you only have room left for 2 more bonds on the Carbon and there's (CH2)3, 3 of them. Where would you put that? And you would also have to connect it to the CH(CH3).

[Borek]

You don't have three CH2, you have a chain of three carbon atoms, just like I draw them.

[nothincomin]

Doesn't the parenthesis indicate that the CH2's are attached to the C?

[Borek]

No, it just means there are three of them.

[nothincomin]

thanks, i got it 7-methyl-3-nonone, is that correct?

And is the name for this compound NH(CH3CHC(CH3)CH2CH3)(CH3) methyl-3-methyl-2-pentene-amine?

[LVJ]

It's 7-methylnonan-3-one.
And I don't think that your amine makes any sense the way you've written it up!

[Juicebox]

Sorry, I counted wrong, it's 4-methyl-1-propoxyhexane